C13H19BrN2O2S — CID 43162521
1-[2-(4-bromophenyl)sulfonylethyl]-1,4-diazepane (PubChem CID 43162521) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfonylethyl]-1,4-diazepane.
| Compound Name | 1-[2-(4-bromophenyl)sulfonylethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 43162521 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfonylethyl]-1,4-diazepane |
| SMILES | O=S(=O)(CCN1CCCNCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrN2O2S/c14-12-2-4-13(5-3-12)19(17,18)11-10-16-8-1-6-15-7-9-16/h2-5,15H,1,6-11H2 |
| InChIKey | XZDYUMREWCTUAA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |