C14H20BrNO3S — CID 60642353
[1-[2-(4-bromophenyl)sulfonylethyl]piperidin-3-yl]methanol (PubChem CID 60642353) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is [1-[2-(4-bromophenyl)sulfonylethyl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-(4-bromophenyl)sulfonylethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 60642353 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [1-[2-(4-bromophenyl)sulfonylethyl]piperidin-3-yl]methanol |
| SMILES | O=S(=O)(CCN1CCCC(CO)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrNO3S/c15-13-3-5-14(6-4-13)20(18,19)9-8-16-7-1-2-12(10-16)11-17/h3-6,12,17H,1-2,7-11H2 |
| InChIKey | PALWNEVIULVECR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |