C16H22N2O3S — CID 71980754
4-[2-[3-(methoxymethyl)piperidin-1-yl]ethylsulfonyl]benzonitrile (PubChem CID 71980754) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-[2-[3-(methoxymethyl)piperidin-1-yl]ethylsulfonyl]benzonitrile.
| Compound Name | 4-[2-[3-(methoxymethyl)piperidin-1-yl]ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 71980754 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-[2-[3-(methoxymethyl)piperidin-1-yl]ethylsulfonyl]benzonitrile |
| SMILES | COCC1CCCN(CCS(=O)(=O)c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-21-13-15-3-2-8-18(12-15)9-10-22(19,20)16-6-4-14(11-17)5-7-16/h4-7,15H,2-3,8-10,12-13H2,1H3 |
| InChIKey | AUWNKJKINCXKSE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |