C16H22N2O2S — CID 103722469
4-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethylsulfonyl]benzonitrile (PubChem CID 103722469) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethylsulfonyl]benzonitrile.
| Compound Name | 4-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 103722469 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethylsulfonyl]benzonitrile |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H22N2O2S/c1-13-4-3-5-14(2)18(13)10-11-21(19,20)16-8-6-15(12-17)7-9-16/h6-9,13-14H,3-5,10-11H2,1-2H3/t13-,14+ |
| InChIKey | BRMANTPKPQSJSR-OKILXGFUSA-N |
| XLogP | 2.59 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |