C17H22N2O2S — CID 71864322
4-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethylsulfonyl]benzonitrile (PubChem CID 71864322) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethylsulfonyl]benzonitrile.
| Compound Name | 4-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 71864322 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethylsulfonyl]benzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)CCN2CCC3CCCCC32)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c18-13-14-5-7-16(8-6-14)22(20,21)12-11-19-10-9-15-3-1-2-4-17(15)19/h5-8,15,17H,1-4,9-12H2 |
| InChIKey | KBFJRHJROKBAMP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |