C15H20N2O2S — CID 79507311
4-[2-(2-ethylpyrrolidin-1-yl)ethylsulfonyl]benzonitrile (PubChem CID 79507311) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-[2-(2-ethylpyrrolidin-1-yl)ethylsulfonyl]benzonitrile.
| Compound Name | 4-[2-(2-ethylpyrrolidin-1-yl)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 79507311 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-[2-(2-ethylpyrrolidin-1-yl)ethylsulfonyl]benzonitrile |
| SMILES | CCC1CCCN1CCS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H20N2O2S/c1-2-14-4-3-9-17(14)10-11-20(18,19)15-7-5-13(12-16)6-8-15/h5-8,14H,2-4,9-11H2,1H3 |
| InChIKey | XQSNXMZYZZTJJS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |