C15H23AuN3O2S3-2 — CID 58131487
[4-[2-[4-(dimethylamino)phenyl]sulfonylethyl]piperazin-1-yl]methanedithiolate;gold (PubChem CID 58131487) has the molecular formula C15H23AuN3O2S3-2 and a molecular weight of 570.54 g/mol. Its IUPAC name is [4-[2-[4-(dimethylamino)phenyl]sulfonylethyl]piperazin-1-yl]methanedithiolate;gold.
| Compound Name | [4-[2-[4-(dimethylamino)phenyl]sulfonylethyl]piperazin-1-yl]methanedithiolate;gold |
|---|---|
| PubChem CID | 58131487 |
| Molecular Formula | C15H23AuN3O2S3-2 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | [4-[2-[4-(dimethylamino)phenyl]sulfonylethyl]piperazin-1-yl]methanedithiolate;gold |
| SMILES | CN(C)c1ccc(S(=O)(=O)CCN2CCN(C([S-])[S-])CC2)cc1.[Au] |
| InChI | InChI=1S/C15H25N3O2S3.Au/c1-16(2)13-3-5-14(6-4-13)23(19,20)12-11-17-7-9-18(10-8-17)15(21)22;/h3-6,15,21-22H,7-12H2,1-2H3;/p-2 |
| InChIKey | RJQVXGHZRWGZOX-UHFFFAOYSA-L |
| XLogP | 0.52 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|