C15H24BrClN2O2S — CID 119920924
1-[1-[2-(4-bromophenyl)sulfonylethyl]piperidin-4-yl]ethanamine;hydrochloride (PubChem CID 119920924) has the molecular formula C15H24BrClN2O2S and a molecular weight of 411.79 g/mol. Its IUPAC name is 1-[1-[2-(4-bromophenyl)sulfonylethyl]piperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[2-(4-bromophenyl)sulfonylethyl]piperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119920924 |
| Molecular Formula | C15H24BrClN2O2S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 1-[1-[2-(4-bromophenyl)sulfonylethyl]piperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCN(CCS(=O)(=O)c2ccc(Br)cc2)CC1.Cl |
| InChI | InChI=1S/C15H23BrN2O2S.ClH/c1-12(17)13-6-8-18(9-7-13)10-11-21(19,20)15-4-2-14(16)3-5-15;/h2-5,12-13H,6-11,17H2,1H3;1H |
| InChIKey | HWLBXESDBAVNTQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |