C13H17N3O9S — CID 178051957
[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyl-methylamino]-methyliminomethanesulfonic acid (PubChem CID 178051957) has the molecular formula C13H17N3O9S and a molecular weight of 391.36 g/mol. Its IUPAC name is [(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyl-methylamino]-methyliminomethanesulfonic acid.
| Compound Name | [(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyl-methylamino]-methyliminomethanesulfonic acid |
|---|---|
| PubChem CID | 178051957 |
| Molecular Formula | C13H17N3O9S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyl-methylamino]-methyliminomethanesulfonic acid |
| SMILES | C/N=C(/N(C)C(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-])S(=O)(=O)O |
| InChI | InChI=1S/C13H17N3O9S/c1-14-12(26(20,21)22)15(2)13(17)25-7-8-5-10(23-3)11(24-4)6-9(8)16(18)19/h5-6H,7H2,1-4H3,(H,20,21,22)/b14-12- |
| InChIKey | KLVQFPGEUJYAEA-OWBHPGMISA-N |
| XLogP | 1.05 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|