C17H21Cl2IN4O2 — CID 111198071
2-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111198071) has the molecular formula C17H21Cl2IN4O2 and a molecular weight of 511.19 g/mol. Its IUPAC name is 2-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111198071 |
| Molecular Formula | C17H21Cl2IN4O2 |
| Molecular Weight | 511.19 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | 2-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC(=O)NCc1ccco1.I |
| InChI | InChI=1S/C17H20Cl2N4O2.HI/c1-2-20-17(22-9-12-5-6-13(18)8-15(12)19)23-11-16(24)21-10-14-4-3-7-25-14;/h3-8H,2,9-11H2,1H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | NTNKSQROUYUCLD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|