C18H21F3N4O3 — CID 111847779
2-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 111847779) has the molecular formula C18H21F3N4O3 and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 111847779 |
| Molecular Formula | C18H21F3N4O3 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H21F3N4O3/c1-2-22-17(25-12-16(26)23-11-14-7-5-9-27-14)24-10-13-6-3-4-8-15(13)28-18(19,20)21/h3-9H,2,10-12H2,1H3,(H,23,26)(H2,22,24,25) |
| InChIKey | RVTOMORAZRDHCB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|