C17H20F3N3O3 — CID 111997939
1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111997939) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111997939 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCC(O)c1ccco1 |
| InChI | InChI=1S/C17H20F3N3O3/c1-2-21-16(23-11-13(24)15-8-5-9-25-15)22-10-12-6-3-4-7-14(12)26-17(18,19)20/h3-9,13,24H,2,10-11H2,1H3,(H2,21,22,23) |
| InChIKey | YNGGSMPEAHXNAD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|