C22H32IN3O4 — CID 111989746
2-[(2-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111989746) has the molecular formula C22H32IN3O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111989746 |
| Molecular Formula | C22H32IN3O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 2-[(2-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC1CCCC1)NCC(O)c1ccco1.I |
| InChI | InChI=1S/C22H31N3O4.HI/c1-3-23-22(25-15-19(26)20-9-6-12-28-20)24-14-16-10-11-18(27-2)13-21(16)29-17-7-4-5-8-17;/h6,9-13,17,19,26H,3-5,7-8,14-15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | JWFRRTOEYDBOHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|