C15H24Cl2IN3O2S — CID 111720294
2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111720294) has the molecular formula C15H24Cl2IN3O2S and a molecular weight of 508.25 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111720294 |
| Molecular Formula | C15H24Cl2IN3O2S |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | 2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1ccc(Cl)cc1Cl)NCCS(C)(=O)=O.I |
| InChI | InChI=1S/C15H23Cl2N3O2S.HI/c1-3-18-15(20-9-10-23(2,21)22)19-8-4-5-12-6-7-13(16)11-14(12)17;/h6-7,11H,3-5,8-10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | MJMAHTSQTYEPJE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|