C21H28Cl2N4O — CID 111720297
2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 111720297) has the molecular formula C21H28Cl2N4O and a molecular weight of 423.39 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 111720297 |
| Molecular Formula | C21H28Cl2N4O |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[3-(2,4-dichlorophenyl)propyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | CCN/C(=N\CCCc1ccc(Cl)cc1Cl)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C21H28Cl2N4O/c1-2-24-21(25-12-4-6-15-27-14-5-3-9-20(27)28)26-13-7-8-17-10-11-18(22)16-19(17)23/h3,5,9-11,14,16H,2,4,6-8,12-13,15H2,1H3,(H2,24,25,26) |
| InChIKey | WUVHQKRVHXQBTR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|