C17H28Cl2IN5 — CID 111828560
2-[(2,4-dichlorophenyl)methyl]-1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111828560) has the molecular formula C17H28Cl2IN5 and a molecular weight of 500.26 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111828560 |
| Molecular Formula | C17H28Cl2IN5 |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC1CN(C)CCN1C.I |
| InChI | InChI=1S/C17H27Cl2N5.HI/c1-4-20-17(21-10-13-5-6-14(18)9-16(13)19)22-11-15-12-23(2)7-8-24(15)3;/h5-6,9,15H,4,7-8,10-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | ZWCYNXGAAKGZQD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|