C15H29IN6O2S — CID 111953796
1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111953796) has the molecular formula C15H29IN6O2S and a molecular weight of 484.41 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111953796 |
| Molecular Formula | C15H29IN6O2S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC1CCN(S(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C15H28N6O2S.HI/c1-4-16-15(18-12-14-5-8-19-20(14)2)17-11-13-6-9-21(10-7-13)24(3,22)23;/h5,8,13H,4,6-7,9-12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | HRFQWYWKTIVYBQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|