C20H30N6O — CID 111954717
1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111954717) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111954717 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC1CCN(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C20H30N6O/c1-4-21-20(23-14-18-8-10-24-25(18)2)22-13-16-9-11-26(15-16)17-6-5-7-19(12-17)27-3/h5-8,10,12,16H,4,9,11,13-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | IUDQEAPOIIHBHB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|