C20H29IN4OS — CID 111939906
1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111939906) has the molecular formula C20H29IN4OS and a molecular weight of 500.45 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111939906 |
| Molecular Formula | C20H29IN4OS |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 1-ethyl-3-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCC1CCN(c2cccc(OC)c2)C1.I |
| InChI | InChI=1S/C20H28N4OS.HI/c1-3-21-20(23-13-17-8-10-26-15-17)22-12-16-7-9-24(14-16)18-5-4-6-19(11-18)25-2;/h4-6,8,10-11,15-16H,3,7,9,12-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | NFCWSBGVCOFKEL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|