About 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid
2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 62818927) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid.
Analyze 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
The IUPAC name of 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid (CID 62818927) is 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid.
What is the SMILES notation for 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
The canonical SMILES for 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid is CN(c1nccs1)C(C)(C)C(=O)O.
What is the InChIKey of 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
The InChIKey is XEQZFHDIYBVUPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-8(2,6(11)12)10(3)7-9-4-5-13-7/h4-5H,1-3H3,(H,11,12).
What are the key properties of 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid?
2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid has a molecular weight of 200.26 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[methyl(1,3-thiazol-2-yl)amino]propanoic acid is sourced from PubChem (CID 62818927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).