C9H12N2O3S — CID 141185862
tert-butyl N-formyl-N-(1,3-thiazol-2-yl)carbamate (PubChem CID 141185862) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is tert-butyl N-formyl-N-(1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-formyl-N-(1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 141185862 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | tert-butyl N-formyl-N-(1,3-thiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C=O)c1nccs1 |
| InChI | InChI=1S/C9H12N2O3S/c1-9(2,3)14-8(13)11(6-12)7-10-4-5-15-7/h4-6H,1-3H3 |
| InChIKey | AGEDWDDHHFTCTD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|