C10H16N2O2S — CID 60828365
4-[propan-2-yl(1,3-thiazol-2-yl)amino]butanoic acid (PubChem CID 60828365) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-[propan-2-yl(1,3-thiazol-2-yl)amino]butanoic acid.
| Compound Name | 4-[propan-2-yl(1,3-thiazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 60828365 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-[propan-2-yl(1,3-thiazol-2-yl)amino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)c1nccs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-8(2)12(6-3-4-9(13)14)10-11-5-7-15-10/h5,7-8H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | UWUZBVWAUWDRKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |