C14H18N2O2S — CID 66353793
4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid (PubChem CID 66353793) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid.
| Compound Name | 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 66353793 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)c1snc2ccccc12 |
| InChI | InChI=1S/C14H18N2O2S/c1-10(2)16(9-5-8-13(17)18)14-11-6-3-4-7-12(11)15-19-14/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | WGMHNSAOPXCGOK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |