4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid

C14H18N2O2S — CID 66353793

IUPAC4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid
SMILESCC(C)N(CCCC(=O)O)c1snc2ccccc12
InChIInChI=1S/C14H18N2O2S/c1-10(2)16(9-5-8-13(17)18)14-11-6-3-4-7-12(11)15-19-14/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,18)
InChIKeyWGMHNSAOPXCGOK-UHFFFAOYSA-N
MW278.38 g/mol
LogP3.38
Rot. Bonds6

About 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid

4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid (PubChem CID 66353793) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid.

Molecular Properties

Compound Name4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid
PubChem CID66353793
Molecular FormulaC14H18N2O2S
Molecular Weight278.38 g/mol
Exact Mass278.11
IUPAC Name4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid
SMILESCC(C)N(CCCC(=O)O)c1snc2ccccc12
InChIInChI=1S/C14H18N2O2S/c1-10(2)16(9-5-8-13(17)18)14-11-6-3-4-7-12(11)15-19-14/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,18)
InChIKeyWGMHNSAOPXCGOK-UHFFFAOYSA-N
XLogP3.38
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.38
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid?
The IUPAC name of 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid (CID 66353793) is 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid.
What is the SMILES notation for 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid?
The canonical SMILES for 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid is CC(C)N(CCCC(=O)O)c1snc2ccccc12.
What is the InChIKey of 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid?
The InChIKey is WGMHNSAOPXCGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S/c1-10(2)16(9-5-8-13(17)18)14-11-6-3-4-7-12(11)15-19-14/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,18).
What are the key properties of 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid?
4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid has a molecular weight of 278.38 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,1-benzothiazol-3-yl(propan-2-yl)amino]butanoic acid is sourced from PubChem (CID 66353793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).