C11H13ClN2S — CID 66353647
N-(2-chloropropyl)-N-methyl-2,1-benzothiazol-3-amine (PubChem CID 66353647) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is N-(2-chloropropyl)-N-methyl-2,1-benzothiazol-3-amine.
| Compound Name | N-(2-chloropropyl)-N-methyl-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 66353647 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-(2-chloropropyl)-N-methyl-2,1-benzothiazol-3-amine |
| SMILES | CC(Cl)CN(C)c1snc2ccccc12 |
| InChI | InChI=1S/C11H13ClN2S/c1-8(12)7-14(2)11-9-5-3-4-6-10(9)13-15-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | KATJXOIBSYEVHV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|