About 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid
4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid (PubChem CID 60828366) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid.
Analyze 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid?
The IUPAC name of 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid (CID 60828366) is 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid.
What is the SMILES notation for 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid?
The canonical SMILES for 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid is Cc1csc(N(CCCC(=O)O)C(C)C)n1.
What is the InChIKey of 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid?
The InChIKey is DFXMBEKLSRVIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-8(2)13(6-4-5-10(14)15)11-12-9(3)7-16-11/h7-8H,4-6H2,1-3H3,(H,14,15).
What are the key properties of 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid?
4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid has a molecular weight of 242.34 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-1,3-thiazol-2-yl)-propan-2-ylamino]butanoic acid is sourced from PubChem (CID 60828366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).