3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid

C10H14N2O2S — CID 82309812

IUPAC3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid
SMILESC=CCN(CCC(=O)O)c1nc(C)cs1
InChIInChI=1S/C10H14N2O2S/c1-3-5-12(6-4-9(13)14)10-11-8(2)7-15-10/h3,7H,1,4-6H2,2H3,(H,13,14)
InChIKeyKITWKIHZUAYOGX-UHFFFAOYSA-N
MW226.30 g/mol
LogP1.92
Rot. Bonds6

About 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid

3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid (PubChem CID 82309812) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid.

Molecular Properties

Compound Name3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid
PubChem CID82309812
Molecular FormulaC10H14N2O2S
Molecular Weight226.30 g/mol
Exact Mass226.08
IUPAC Name3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid
SMILESC=CCN(CCC(=O)O)c1nc(C)cs1
InChIInChI=1S/C10H14N2O2S/c1-3-5-12(6-4-9(13)14)10-11-8(2)7-15-10/h3,7H,1,4-6H2,2H3,(H,13,14)
InChIKeyKITWKIHZUAYOGX-UHFFFAOYSA-N
XLogP1.92
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.30
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid?
The IUPAC name of 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid (CID 82309812) is 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid.
What is the SMILES notation for 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid?
The canonical SMILES for 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid is C=CCN(CCC(=O)O)c1nc(C)cs1.
What is the InChIKey of 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid?
The InChIKey is KITWKIHZUAYOGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-3-5-12(6-4-9(13)14)10-11-8(2)7-15-10/h3,7H,1,4-6H2,2H3,(H,13,14).
What are the key properties of 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid?
3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid has a molecular weight of 226.30 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid is sourced from PubChem (CID 82309812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).