C12H18N2O2S — CID 82309818
3-[(4-propan-2-yl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid (PubChem CID 82309818) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-[(4-propan-2-yl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid.
| Compound Name | 3-[(4-propan-2-yl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid |
|---|---|
| PubChem CID | 82309818 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[(4-propan-2-yl-1,3-thiazol-2-yl)-prop-2-enylamino]propanoic acid |
| SMILES | C=CCN(CCC(=O)O)c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C12H18N2O2S/c1-4-6-14(7-5-11(15)16)12-13-10(8-17-12)9(2)3/h4,8-9H,1,5-7H2,2-3H3,(H,15,16) |
| InChIKey | PEGPTAZGPYWJOV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|