C12H13Cl2NO2 — CID 82317554
3-(2,6-dichloro-N-prop-2-enylanilino)propanoic acid (PubChem CID 82317554) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 3-(2,6-dichloro-N-prop-2-enylanilino)propanoic acid.
| Compound Name | 3-(2,6-dichloro-N-prop-2-enylanilino)propanoic acid |
|---|---|
| PubChem CID | 82317554 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-(2,6-dichloro-N-prop-2-enylanilino)propanoic acid |
| SMILES | C=CCN(CCC(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO2/c1-2-7-15(8-6-11(16)17)12-9(13)4-3-5-10(12)14/h2-5H,1,6-8H2,(H,16,17) |
| InChIKey | GXZBOCNFMBGSAO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|