C17H17Cl2MgNO2 — CID 173440972
magnesium;2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetic acid;hydride (PubChem CID 173440972) has the molecular formula C17H17Cl2MgNO2 and a molecular weight of 362.54 g/mol. Its IUPAC name is magnesium;2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetic acid;hydride.
| Compound Name | magnesium;2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetic acid;hydride |
|---|---|
| PubChem CID | 173440972 |
| Molecular Formula | C17H17Cl2MgNO2 |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | magnesium;2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetic acid;hydride |
| SMILES | C=CCN(c1ccccc1CC(=O)O)c1c(Cl)cccc1Cl.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C17H15Cl2NO2.Mg.2H/c1-2-10-20(17-13(18)7-5-8-14(17)19)15-9-4-3-6-12(15)11-16(21)22;;;/h2-9H,1,10-11H2,(H,21,22);;;/q;+2;2*-1 |
| InChIKey | CJGNZAXDNYLJSL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|