C34H28BaCl4N2O4 — CID 88775924
barium(2+);bis(2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetate) (PubChem CID 88775924) has the molecular formula C34H28BaCl4N2O4 and a molecular weight of 807.75 g/mol. Its IUPAC name is barium(2+);bis(2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetate).
| Compound Name | barium(2+);bis(2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetate) |
|---|---|
| PubChem CID | 88775924 |
| Molecular Formula | C34H28BaCl4N2O4 |
| Molecular Weight | 807.75 g/mol |
| Exact Mass | 805.99 |
| IUPAC Name | barium(2+);bis(2-[2-(2,6-dichloro-N-prop-2-enylanilino)phenyl]acetate) |
| SMILES | C=CCN(c1ccccc1CC(=O)[O-])c1c(Cl)cccc1Cl.C=CCN(c1ccccc1CC(=O)[O-])c1c(Cl)cccc1Cl.[Ba+2] |
| InChI | InChI=1S/2C17H15Cl2NO2.Ba/c2*1-2-10-20(17-13(18)7-5-8-14(17)19)15-9-4-3-6-12(15)11-16(21)22;/h2*2-9H,1,10-11H2,(H,21,22);/q;;+2/p-2 |
| InChIKey | GZTLUSRNBMWWCK-UHFFFAOYSA-L |
| XLogP | 6.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|