3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid

C16H15Cl2NO2 — CID 60839248

IUPAC3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid
SMILESO=C(O)CCN(Cc1c(Cl)cccc1Cl)c1ccccc1
InChIInChI=1S/C16H15Cl2NO2/c17-14-7-4-8-15(18)13(14)11-19(10-9-16(20)21)12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,21)
InChIKeyOKIWMNBWJBNEPW-UHFFFAOYSA-N
MW324.21 g/mol
LogP4.47
Rot. Bonds6

About 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid

3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid (PubChem CID 60839248) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid.

Molecular Properties

Compound Name3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid
PubChem CID60839248
Molecular FormulaC16H15Cl2NO2
Molecular Weight324.21 g/mol
Exact Mass323.05
IUPAC Name3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid
SMILESO=C(O)CCN(Cc1c(Cl)cccc1Cl)c1ccccc1
InChIInChI=1S/C16H15Cl2NO2/c17-14-7-4-8-15(18)13(14)11-19(10-9-16(20)21)12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,21)
InChIKeyOKIWMNBWJBNEPW-UHFFFAOYSA-N
XLogP4.47
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.21
LogP ≤ 54.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid?
The IUPAC name of 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid (CID 60839248) is 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid.
What is the SMILES notation for 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid?
The canonical SMILES for 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid is O=C(O)CCN(Cc1c(Cl)cccc1Cl)c1ccccc1.
What is the InChIKey of 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid?
The InChIKey is OKIWMNBWJBNEPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO2/c17-14-7-4-8-15(18)13(14)11-19(10-9-16(20)21)12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,21).
What are the key properties of 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid?
3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid has a molecular weight of 324.21 g/mol, XLogP of 4.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid is sourced from PubChem (CID 60839248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).