C16H15Cl2NO2 — CID 60839248
3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid (PubChem CID 60839248) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid.
| Compound Name | 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 60839248 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-[N-[(2,6-dichlorophenyl)methyl]anilino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2NO2/c17-14-7-4-8-15(18)13(14)11-19(10-9-16(20)21)12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,21) |
| InChIKey | OKIWMNBWJBNEPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |