C6H8N4O3S — CID 174995837
1-ethyl-3-nitro-1-(1,3-thiazol-2-yl)urea (PubChem CID 174995837) has the molecular formula C6H8N4O3S and a molecular weight of 216.22 g/mol. Its IUPAC name is 1-ethyl-3-nitro-1-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-ethyl-3-nitro-1-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 174995837 |
| Molecular Formula | C6H8N4O3S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 1-ethyl-3-nitro-1-(1,3-thiazol-2-yl)urea |
| SMILES | CCN(C(=O)N[N+](=O)[O-])c1nccs1 |
| InChI | InChI=1S/C6H8N4O3S/c1-2-9(5(11)8-10(12)13)6-7-3-4-14-6/h3-4H,2H2,1H3,(H,8,11) |
| InChIKey | SLMBLRJDGUDZBI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|