C20H34N4O3S — CID 4068648
N-(2-morpholin-4-ylethyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]nonanamide (PubChem CID 4068648) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]nonanamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]nonanamide |
|---|---|
| PubChem CID | 4068648 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCN1CCOCC1)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C20H34N4O3S/c1-2-3-4-5-6-7-8-19(26)24(11-10-23-12-14-27-15-13-23)17-18(25)22-20-21-9-16-28-20/h9,16H,2-8,10-15,17H2,1H3,(H,21,22,25) |
| InChIKey | CGJWKHDMZIUCLY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|