C13H11Cl2N3O2S — CID 23822862
N-(3,4-dichlorophenyl)-N'-(1,3-thiazol-2-yl)butanediamide (PubChem CID 23822862) has the molecular formula C13H11Cl2N3O2S and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N'-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N-(3,4-dichlorophenyl)-N'-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 23822862 |
| Molecular Formula | C13H11Cl2N3O2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N'-(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1nccs1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N3O2S/c14-9-2-1-8(7-10(9)15)17-11(19)3-4-12(20)18-13-16-5-6-21-13/h1-2,5-7H,3-4H2,(H,17,19)(H,16,18,20) |
| InChIKey | IMWJQXIGITVRMA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |