C12H9F2N3O2S — CID 47334895
3,4-difluoro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide (PubChem CID 47334895) has the molecular formula C12H9F2N3O2S and a molecular weight of 297.29 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide.
| Compound Name | 3,4-difluoro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 47334895 |
| Molecular Formula | C12H9F2N3O2S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3,4-difluoro-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)c(F)c1)Nc1nccs1 |
| InChI | InChI=1S/C12H9F2N3O2S/c13-8-2-1-7(5-9(8)14)11(19)16-6-10(18)17-12-15-3-4-20-12/h1-5H,6H2,(H,16,19)(H,15,17,18) |
| InChIKey | UCYGJYJSNVTFNW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |