C17H12F2N2OS — CID 110445702
3,4-difluoro-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]benzamide (PubChem CID 110445702) has the molecular formula C17H12F2N2OS and a molecular weight of 330.36 g/mol. Its IUPAC name is 3,4-difluoro-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]benzamide.
| Compound Name | 3,4-difluoro-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 110445702 |
| Molecular Formula | C17H12F2N2OS |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3,4-difluoro-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1-c1nccs1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12F2N2OS/c18-14-6-5-11(9-15(14)19)16(22)21-10-12-3-1-2-4-13(12)17-20-7-8-23-17/h1-9H,10H2,(H,21,22) |
| InChIKey | RCOBMFUGKGUODA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |