C12H13N3OS — CID 110459394
2-amino-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]acetamide (PubChem CID 110459394) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-amino-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 110459394 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-amino-N-[[2-(1,3-thiazol-2-yl)phenyl]methyl]acetamide |
| SMILES | NCC(=O)NCc1ccccc1-c1nccs1 |
| InChI | InChI=1S/C12H13N3OS/c13-7-11(16)15-8-9-3-1-2-4-10(9)12-14-5-6-17-12/h1-6H,7-8,13H2,(H,15,16) |
| InChIKey | DEVTXOMGVTYRFR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |