C11H7F3N2OS — CID 110487515
N-(1,3-thiazol-2-yl)-2-(2,4,6-trifluorophenyl)acetamide (PubChem CID 110487515) has the molecular formula C11H7F3N2OS and a molecular weight of 272.25 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-(2,4,6-trifluorophenyl)acetamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-(2,4,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110487515 |
| Molecular Formula | C11H7F3N2OS |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-(2,4,6-trifluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)cc(F)cc1F)Nc1nccs1 |
| InChI | InChI=1S/C11H7F3N2OS/c12-6-3-8(13)7(9(14)4-6)5-10(17)16-11-15-1-2-18-11/h1-4H,5H2,(H,15,16,17) |
| InChIKey | GMIKBROJAJEFPO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |