C15H18ClF3N2O2 — CID 31519985
(2S)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2S)-2-methylmorpholin-4-yl]propanamide (PubChem CID 31519985) has the molecular formula C15H18ClF3N2O2 and a molecular weight of 350.77 g/mol. Its IUPAC name is (2S)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2S)-2-methylmorpholin-4-yl]propanamide.
| Compound Name | (2S)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2S)-2-methylmorpholin-4-yl]propanamide |
|---|---|
| PubChem CID | 31519985 |
| Molecular Formula | C15H18ClF3N2O2 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (2S)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[(2S)-2-methylmorpholin-4-yl]propanamide |
| SMILES | C[C@H]1CN([C@@H](C)C(=O)Nc2ccc(Cl)cc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C15H18ClF3N2O2/c1-9-8-21(5-6-23-9)10(2)14(22)20-13-4-3-11(16)7-12(13)15(17,18)19/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,20,22)/t9-,10-/m0/s1 |
| InChIKey | NKCHBLDKWLTXSA-UWVGGRQHSA-N |
| XLogP | 3.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |