C19H13ClF3NO4 — CID 8555431
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8555431) has the molecular formula C19H13ClF3NO4 and a molecular weight of 411.76 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8555431 |
| Molecular Formula | C19H13ClF3NO4 |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H13ClF3NO4/c1-8-11-7-10(20)3-6-14(11)28-17(8)19(26)27-9(2)18(25)24-13-5-4-12(21)15(22)16(13)23/h3-7,9H,1-2H3,(H,24,25)/t9-/m0/s1 |
| InChIKey | JIIZKAZNYTZROS-VIFPVBQESA-N |
| XLogP | 5.00 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|