C16H18FNO5 — CID 8950534
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8950534) has the molecular formula C16H18FNO5 and a molecular weight of 323.32 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8950534 |
| Molecular Formula | C16H18FNO5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C16H18FNO5/c1-9-12-8-11(17)4-5-13(12)23-14(9)16(20)22-10(2)15(19)18-6-7-21-3/h4-5,8,10H,6-7H2,1-3H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | GDISFDKNKHYVGS-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|