C23H25F3N2O5 — CID 55323574
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate (PubChem CID 55323574) has the molecular formula C23H25F3N2O5 and a molecular weight of 466.46 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 55323574 |
| Molecular Formula | C23H25F3N2O5 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)OC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)ccc1C(C)C |
| InChI | InChI=1S/C23H25F3N2O5/c1-12(2)16-6-5-15(9-13(16)3)32-11-20(30)33-14(4)23(31)27-10-19(29)28-18-8-7-17(24)21(25)22(18)26/h5-9,12,14H,10-11H2,1-4H3,(H,27,31)(H,28,29) |
| InChIKey | VVNNKSBICVRXBH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|