C22H30N2O2S — CID 162639530
5-(dimethylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-2-sulfonamide (PubChem CID 162639530) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-2-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 162639530 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 5-(dimethylamino)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]naphthalene-2-sulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/CNS(=O)(=O)c1ccc2c(N(C)C)cccc2c1 |
| InChI | InChI=1S/C22H30N2O2S/c1-17(2)8-6-9-18(3)14-15-23-27(25,26)20-12-13-21-19(16-20)10-7-11-22(21)24(4)5/h7-8,10-14,16,23H,6,9,15H2,1-5H3/b18-14+ |
| InChIKey | MKUXYBXOOYOHHN-NBVRZTHBSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|