C11H13BrClNO2S — CID 106546881
3-bromo-4-chloro-N-(3-methylbut-2-enyl)benzenesulfonamide (PubChem CID 106546881) has the molecular formula C11H13BrClNO2S and a molecular weight of 338.65 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(3-methylbut-2-enyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-(3-methylbut-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106546881 |
| Molecular Formula | C11H13BrClNO2S |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 3-bromo-4-chloro-N-(3-methylbut-2-enyl)benzenesulfonamide |
| SMILES | CC(C)=CCNS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H13BrClNO2S/c1-8(2)5-6-14-17(15,16)9-3-4-11(13)10(12)7-9/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | ZRMPMDLXSGEUIR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|