C12H16BrClN2O3S — CID 106545765
2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N,N-diethylacetamide (PubChem CID 106545765) has the molecular formula C12H16BrClN2O3S and a molecular weight of 383.70 g/mol. Its IUPAC name is 2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 106545765 |
| Molecular Formula | C12H16BrClN2O3S |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H16BrClN2O3S/c1-3-16(4-2)12(17)8-15-20(18,19)9-5-6-11(14)10(13)7-9/h5-7,15H,3-4,8H2,1-2H3 |
| InChIKey | OXLGTDADTIHTII-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |