C13H20BrN3O3S — CID 114626087
2-[(5-amino-4-bromo-2-methylphenyl)sulfonylamino]-N,N-diethylacetamide (PubChem CID 114626087) has the molecular formula C13H20BrN3O3S and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-[(5-amino-4-bromo-2-methylphenyl)sulfonylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(5-amino-4-bromo-2-methylphenyl)sulfonylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 114626087 |
| Molecular Formula | C13H20BrN3O3S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-[(5-amino-4-bromo-2-methylphenyl)sulfonylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNS(=O)(=O)c1cc(N)c(Br)cc1C |
| InChI | InChI=1S/C13H20BrN3O3S/c1-4-17(5-2)13(18)8-16-21(19,20)12-7-11(15)10(14)6-9(12)3/h6-7,16H,4-5,8,15H2,1-3H3 |
| InChIKey | QWUOMXYTQWNZSP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|