C12H19N3O5S2 — CID 55433934
N,N-diethyl-2-[(4-sulfamoylphenyl)sulfonylamino]acetamide (PubChem CID 55433934) has the molecular formula C12H19N3O5S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N,N-diethyl-2-[(4-sulfamoylphenyl)sulfonylamino]acetamide.
| Compound Name | N,N-diethyl-2-[(4-sulfamoylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 55433934 |
| Molecular Formula | C12H19N3O5S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N,N-diethyl-2-[(4-sulfamoylphenyl)sulfonylamino]acetamide |
| SMILES | CCN(CC)C(=O)CNS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19N3O5S2/c1-3-15(4-2)12(16)9-14-22(19,20)11-7-5-10(6-8-11)21(13,17)18/h5-8,14H,3-4,9H2,1-2H3,(H2,13,17,18) |
| InChIKey | XPQMSACYJMHIDU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |