C11H17N3O3S — CID 43310982
2-[[4-(aminomethyl)phenyl]sulfonylamino]-N,N-dimethylacetamide (PubChem CID 43310982) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]sulfonylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[4-(aminomethyl)phenyl]sulfonylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43310982 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]sulfonylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C11H17N3O3S/c1-14(2)11(15)8-13-18(16,17)10-5-3-9(7-12)4-6-10/h3-6,13H,7-8,12H2,1-2H3 |
| InChIKey | GVKSHQSAYUKNKW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |