C14H18N2O4S — CID 60824309
2-[[4-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N,N-dimethylacetamide (PubChem CID 60824309) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[[4-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[4-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60824309 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[[4-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1ccc(C#CCCO)cc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-16(2)14(18)11-15-21(19,20)13-8-6-12(7-9-13)5-3-4-10-17/h6-9,15,17H,4,10-11H2,1-2H3 |
| InChIKey | MVJSDDBNCCIWBO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|