C12H12ClNO4S — CID 170468673
2-[[4-(4-chlorobut-1-ynyl)phenyl]sulfonylamino]acetic acid (PubChem CID 170468673) has the molecular formula C12H12ClNO4S and a molecular weight of 301.75 g/mol. Its IUPAC name is 2-[[4-(4-chlorobut-1-ynyl)phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-(4-chlorobut-1-ynyl)phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 170468673 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-[[4-(4-chlorobut-1-ynyl)phenyl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(C#CCCCl)cc1 |
| InChI | InChI=1S/C12H12ClNO4S/c13-8-2-1-3-10-4-6-11(7-5-10)19(17,18)14-9-12(15)16/h4-7,14H,2,8-9H2,(H,15,16) |
| InChIKey | DOUPJMIDBIVQNM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|